C18H16ClN3O3 — CID 84571672
N-(4-chloro-2-methylphenyl)-2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 84571672) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 84571672 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CN1C(=O)NC(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H16ClN3O3/c1-11-9-13(19)7-8-14(11)20-15(23)10-22-17(24)16(21-18(22)25)12-5-3-2-4-6-12/h2-9,16H,10H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | YNYXIIAPRWTUSN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|