C15H20Cl2N2O3 — CID 119908238
1-[2-(4-chloro-2-methylanilino)-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 119908238) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 1-[2-(4-chloro-2-methylanilino)-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-(4-chloro-2-methylanilino)-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119908238 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[2-(4-chloro-2-methylanilino)-2-oxoethyl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CN1CCC(C(=O)O)CC1.Cl |
| InChI | InChI=1S/C15H19ClN2O3.ClH/c1-10-8-12(16)2-3-13(10)17-14(19)9-18-6-4-11(5-7-18)15(20)21;/h2-3,8,11H,4-7,9H2,1H3,(H,17,19)(H,20,21);1H |
| InChIKey | WVCSYQMVXWZIKV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |