C23H20N4O3 — CID 84571858
N-(4-anilinophenyl)-2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide (PubChem CID 84571858) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide.
| Compound Name | N-(4-anilinophenyl)-2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 84571858 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-(4-anilinophenyl)-2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC(c2ccccc2)C1=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N4O3/c28-20(15-27-22(29)21(26-23(27)30)16-7-3-1-4-8-16)25-19-13-11-18(12-14-19)24-17-9-5-2-6-10-17/h1-14,21,24H,15H2,(H,25,28)(H,26,30) |
| InChIKey | DKPOODWPXYJFDU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|