C15H16ClN3O3 — CID 24534157
N-(4-chloro-2-methylphenyl)-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)acetamide (PubChem CID 24534157) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)acetamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 24534157 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CN1C(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C15H16ClN3O3/c1-9-7-10(16)4-5-11(9)17-13(20)8-19-14(21)12-3-2-6-18(12)15(19)22/h4-5,7,12H,2-3,6,8H2,1H3,(H,17,20) |
| InChIKey | HEZHLFUDBNKHCN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|