C20H21ClN4O2 — CID 20886115
2-(11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl)-N-(2,3-dimethylphenyl)acetamide (PubChem CID 20886115) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 2-(11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl)-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-(11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl)-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 20886115 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-(11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl)-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)C3CCCN3c3ncc(Cl)cc32)c1C |
| InChI | InChI=1S/C20H21ClN4O2/c1-12-5-3-6-15(13(12)2)23-18(26)11-25-17-9-14(21)10-22-19(17)24-8-4-7-16(24)20(25)27/h3,5-6,9-10,16H,4,7-8,11H2,1-2H3,(H,23,26) |
| InChIKey | KEJXTFYUMWAUIG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |