C19H26N4O2 — CID 92583873
N-[(1R,2S)-2-methylcyclohexyl]-2-[(6R)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]acetamide (PubChem CID 92583873) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[(1R,2S)-2-methylcyclohexyl]-2-[(6R)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]acetamide.
| Compound Name | N-[(1R,2S)-2-methylcyclohexyl]-2-[(6R)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]acetamide |
|---|---|
| PubChem CID | 92583873 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[(1R,2S)-2-methylcyclohexyl]-2-[(6R)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]acetamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)CN1C(=O)[C@H]2CCCN2c2ncccc21 |
| InChI | InChI=1S/C19H26N4O2/c1-13-6-2-3-7-14(13)21-17(24)12-23-15-8-4-10-20-18(15)22-11-5-9-16(22)19(23)25/h4,8,10,13-14,16H,2-3,5-7,9,11-12H2,1H3,(H,21,24)/t13-,14+,16+/m0/s1 |
| InChIKey | BXJNRXUKTXASOW-SQWLQELKSA-N |
| XLogP | 2.09 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |