C17H18N4O3 — CID 95791909
N-(furan-2-ylmethyl)-2-[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]acetamide (PubChem CID 95791909) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]acetamide |
|---|---|
| PubChem CID | 95791909 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(6S)-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]acetamide |
| SMILES | O=C(CN1C(=O)[C@@H]2CCCN2c2ncccc21)NCc1ccco1 |
| InChI | InChI=1S/C17H18N4O3/c22-15(19-10-12-4-3-9-24-12)11-21-13-5-1-7-18-16(13)20-8-2-6-14(20)17(21)23/h1,3-5,7,9,14H,2,6,8,10-11H2,(H,19,22)/t14-/m0/s1 |
| InChIKey | TYUNOCQLBXBWAS-AWEZNQCLSA-N |
| XLogP | 1.31 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |