C17H23N3O2S — CID 98466113
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide (PubChem CID 98466113) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide |
|---|---|
| PubChem CID | 98466113 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)acetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)CN1C(=O)CSc2ncccc21 |
| InChI | InChI=1S/C17H23N3O2S/c1-11-5-3-6-13(12(11)2)19-15(21)9-20-14-7-4-8-18-17(14)23-10-16(20)22/h4,7-8,11-13H,3,5-6,9-10H2,1-2H3,(H,19,21)/t11-,12+,13-/m1/s1 |
| InChIKey | OUFINTQVLFBYEJ-FRRDWIJNSA-N |
| XLogP | 2.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |