C19H24N2O — CID 98701498
N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-quinolin-8-ylacetamide (PubChem CID 98701498) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-quinolin-8-ylacetamide.
| Compound Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-quinolin-8-ylacetamide |
|---|---|
| PubChem CID | 98701498 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-quinolin-8-ylacetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)Cc1cccc2cccnc12 |
| InChI | InChI=1S/C19H24N2O/c1-13-6-3-10-17(14(13)2)21-18(22)12-16-8-4-7-15-9-5-11-20-19(15)16/h4-5,7-9,11,13-14,17H,3,6,10,12H2,1-2H3,(H,21,22)/t13-,14+,17+/m1/s1 |
| InChIKey | RQZIUTDNRCURFR-KEYYUXOJSA-N |
| XLogP | 3.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |