C19H22Br2N2O2 — CID 23737405
2-(5,7-dibromoquinolin-8-yl)oxy-N-(2,3-dimethylcyclohexyl)acetamide (PubChem CID 23737405) has the molecular formula C19H22Br2N2O2 and a molecular weight of 470.21 g/mol. Its IUPAC name is 2-(5,7-dibromoquinolin-8-yl)oxy-N-(2,3-dimethylcyclohexyl)acetamide.
| Compound Name | 2-(5,7-dibromoquinolin-8-yl)oxy-N-(2,3-dimethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 23737405 |
| Molecular Formula | C19H22Br2N2O2 |
| Molecular Weight | 470.21 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | 2-(5,7-dibromoquinolin-8-yl)oxy-N-(2,3-dimethylcyclohexyl)acetamide |
| SMILES | CC1CCCC(NC(=O)COc2c(Br)cc(Br)c3cccnc23)C1C |
| InChI | InChI=1S/C19H22Br2N2O2/c1-11-5-3-7-16(12(11)2)23-17(24)10-25-19-15(21)9-14(20)13-6-4-8-22-18(13)19/h4,6,8-9,11-12,16H,3,5,7,10H2,1-2H3,(H,23,24) |
| InChIKey | CHLKQMTUVUUPHK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.21 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |