C18H22N2OS — CID 1276988
N-[(1S,2S)-2-methylcyclohexyl]-2-quinolin-8-ylsulfanylacetamide (PubChem CID 1276988) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclohexyl]-2-quinolin-8-ylsulfanylacetamide.
| Compound Name | N-[(1S,2S)-2-methylcyclohexyl]-2-quinolin-8-ylsulfanylacetamide |
|---|---|
| PubChem CID | 1276988 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclohexyl]-2-quinolin-8-ylsulfanylacetamide |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)CSc1cccc2cccnc12 |
| InChI | InChI=1S/C18H22N2OS/c1-13-6-2-3-9-15(13)20-17(21)12-22-16-10-4-7-14-8-5-11-19-18(14)16/h4-5,7-8,10-11,13,15H,2-3,6,9,12H2,1H3,(H,20,21)/t13-,15-/m0/s1 |
| InChIKey | PWDTXJJCWLYPRC-ZFWWWQNUSA-N |
| XLogP | 4.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |