C19H16ClF3N4O2 — CID 92668129
2-[(6R)-11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 92668129) has the molecular formula C19H16ClF3N4O2 and a molecular weight of 424.81 g/mol. Its IUPAC name is 2-[(6R)-11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(6R)-11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 92668129 |
| Molecular Formula | C19H16ClF3N4O2 |
| Molecular Weight | 424.81 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-[(6R)-11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CCCN2c2ncc(Cl)cc21)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16ClF3N4O2/c20-12-8-15-17(24-9-12)26-6-2-5-14(26)18(29)27(15)10-16(28)25-13-4-1-3-11(7-13)19(21,22)23/h1,3-4,7-9,14H,2,5-6,10H2,(H,25,28)/t14-/m1/s1 |
| InChIKey | SWRBDQCTTGFZAP-CQSZACIVSA-N |
| XLogP | 3.71 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.81 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |