C21H13F3N2O3 — CID 113202064
2-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 113202064) has the molecular formula C21H13F3N2O3 and a molecular weight of 398.34 g/mol. Its IUPAC name is 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 113202064 |
| Molecular Formula | C21H13F3N2O3 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)c2cccc3cccc(c23)C1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H13F3N2O3/c22-21(23,24)13-6-3-7-14(10-13)25-17(27)11-26-19(28)15-8-1-4-12-5-2-9-16(18(12)15)20(26)29/h1-10H,11H2,(H,25,27) |
| InChIKey | PTLBLCILDHHRAG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|