C19H13F3N2O — CID 35794746
1-[[3-(trifluoromethyl)anilino]methyl]benzo[cd]indol-2-one (PubChem CID 35794746) has the molecular formula C19H13F3N2O and a molecular weight of 342.32 g/mol. Its IUPAC name is 1-[[3-(trifluoromethyl)anilino]methyl]benzo[cd]indol-2-one.
| Compound Name | 1-[[3-(trifluoromethyl)anilino]methyl]benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 35794746 |
| Molecular Formula | C19H13F3N2O |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[[3-(trifluoromethyl)anilino]methyl]benzo[cd]indol-2-one |
| SMILES | O=C1c2cccc3cccc(c23)N1CNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13F3N2O/c20-19(21,22)13-6-3-7-14(10-13)23-11-24-16-9-2-5-12-4-1-8-15(17(12)16)18(24)25/h1-10,23H,11H2 |
| InChIKey | BQHRYRKFAAPUMY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |