C18H15Br2F3N2O3 — CID 124713017
2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 124713017) has the molecular formula C18H15Br2F3N2O3 and a molecular weight of 524.13 g/mol. Its IUPAC name is 2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 124713017 |
| Molecular Formula | C18H15Br2F3N2O3 |
| Molecular Weight | 524.13 g/mol |
| Exact Mass | 521.94 |
| IUPAC Name | 2-[(1R,2S,6S,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@H]3Br)[C@H]2C1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15Br2F3N2O3/c19-14-9-5-10(15(14)20)13-12(9)16(27)25(17(13)28)6-11(26)24-8-3-1-2-7(4-8)18(21,22)23/h1-4,9-10,12-15H,5-6H2,(H,24,26)/t9-,10-,12-,13-,14+,15+/m1/s1 |
| InChIKey | DEMWVQANCKHZPI-SLQSZJTJSA-N |
| XLogP | 3.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|