C16H12Br2F3NO2 — CID 23306673
(1R,2R,6R,7S,8R,9S)-8,9-dibromo-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 23306673) has the molecular formula C16H12Br2F3NO2 and a molecular weight of 467.08 g/mol. Its IUPAC name is (1R,2R,6R,7S,8R,9S)-8,9-dibromo-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6R,7S,8R,9S)-8,9-dibromo-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 23306673 |
| Molecular Formula | C16H12Br2F3NO2 |
| Molecular Weight | 467.08 g/mol |
| Exact Mass | 464.92 |
| IUPAC Name | (1R,2R,6R,7S,8R,9S)-8,9-dibromo-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@H]2[C@@H]3C[C@@H]([C@H](Br)[C@@H]3Br)[C@@H]2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12Br2F3NO2/c17-12-8-5-9(13(12)18)11-10(8)14(23)22(15(11)24)7-3-1-2-6(4-7)16(19,20)21/h1-4,8-13H,5H2/t8-,9+,10-,11-,12+,13-/m0/s1 |
| InChIKey | JAFJTLMZCVSLGT-JOGIVDDZSA-N |
| XLogP | 3.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.08 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|