C13H10F3NO3 — CID 115009972
6-(hydroxymethyl)-3-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 115009972) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is 6-(hydroxymethyl)-3-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 6-(hydroxymethyl)-3-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 115009972 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 6-(hydroxymethyl)-3-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1C2C(CO)C2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F3NO3/c14-13(15,16)6-2-1-3-7(4-6)17-11(19)9-8(5-18)10(9)12(17)20/h1-4,8-10,18H,5H2 |
| InChIKey | OWYXBWFCAWFTSQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|