C16H12F3NO4 — CID 98211632
(3aS,4R,7R,7aS)-7-(hydroxymethyl)-2-[3-(trifluoromethyl)phenyl]-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 98211632) has the molecular formula C16H12F3NO4 and a molecular weight of 339.27 g/mol. Its IUPAC name is (3aS,4R,7R,7aS)-7-(hydroxymethyl)-2-[3-(trifluoromethyl)phenyl]-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7R,7aS)-7-(hydroxymethyl)-2-[3-(trifluoromethyl)phenyl]-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98211632 |
| Molecular Formula | C16H12F3NO4 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (3aS,4R,7R,7aS)-7-(hydroxymethyl)-2-[3-(trifluoromethyl)phenyl]-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@](CO)(O3)[C@H]2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F3NO4/c17-16(18,19)8-2-1-3-9(6-8)20-13(22)11-10-4-5-15(7-21,24-10)12(11)14(20)23/h1-6,10-12,21H,7H2/t10-,11-,12-,15+/m1/s1 |
| InChIKey | DAWJZTJNMMPJLJ-BLTAXRJOSA-N |
| XLogP | 1.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|