C17H15NO6 — CID 98593239
[3-[(3aS,4R,7R,7aS)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]phenyl] acetate (PubChem CID 98593239) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is [3-[(3aS,4R,7R,7aS)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]phenyl] acetate.
| Compound Name | [3-[(3aS,4R,7R,7aS)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 98593239 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [3-[(3aS,4R,7R,7aS)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(N2C(=O)[C@@H]3[C@H]4C=C[C@@](CO)(O4)[C@H]3C2=O)c1 |
| InChI | InChI=1S/C17H15NO6/c1-9(20)23-11-4-2-3-10(7-11)18-15(21)13-12-5-6-17(8-19,24-12)14(13)16(18)22/h2-7,12-14,19H,8H2,1H3/t12-,13-,14-,17+/m1/s1 |
| InChIKey | GTCXUQXCQZZPNN-WBOJAVRRSA-N |
| XLogP | 0.42 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|