C17H14N2O8 — CID 126066101
[4-[(3aR,4R,7R,7aS)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-nitrophenyl] acetate (PubChem CID 126066101) has the molecular formula C17H14N2O8 and a molecular weight of 374.31 g/mol. Its IUPAC name is [4-[(3aR,4R,7R,7aS)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-nitrophenyl] acetate.
| Compound Name | [4-[(3aR,4R,7R,7aS)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-nitrophenyl] acetate |
|---|---|
| PubChem CID | 126066101 |
| Molecular Formula | C17H14N2O8 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [4-[(3aR,4R,7R,7aS)-7-(hydroxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]-2-nitrophenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)[C@H]3[C@H]4C=C[C@@](CO)(O4)[C@H]3C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N2O8/c1-8(21)26-11-3-2-9(6-10(11)19(24)25)18-15(22)13-12-4-5-17(7-20,27-12)14(13)16(18)23/h2-6,12-14,20H,7H2,1H3/t12-,13+,14-,17+/m1/s1 |
| InChIKey | XFWQJMJWZUTCDS-OEUWWYETSA-N |
| XLogP | 0.33 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|