C22H25ClN4O4 — CID 4259932
2-(11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl)-N-[2-(2,5-dimethoxyphenyl)ethyl]acetamide (PubChem CID 4259932) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is 2-(11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl)-N-[2-(2,5-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl)-N-[2-(2,5-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 4259932 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-(11-chloro-7-oxo-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),10,12-trien-8-yl)-N-[2-(2,5-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(OC)c(CCNC(=O)CN2C(=O)C3CCCN3c3ncc(Cl)cc32)c1 |
| InChI | InChI=1S/C22H25ClN4O4/c1-30-16-5-6-19(31-2)14(10-16)7-8-24-20(28)13-27-18-11-15(23)12-25-21(18)26-9-3-4-17(26)22(27)29/h5-6,10-12,17H,3-4,7-9,13H2,1-2H3,(H,24,28) |
| InChIKey | IRDFIDPGFVMYQQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |