C17H26N2O4 — CID 110601119
N-[2-[2-(2,5-dimethoxyphenyl)ethylamino]-2-oxoethyl]pentanamide (PubChem CID 110601119) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[2-[2-(2,5-dimethoxyphenyl)ethylamino]-2-oxoethyl]pentanamide.
| Compound Name | N-[2-[2-(2,5-dimethoxyphenyl)ethylamino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 110601119 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[2-[2-(2,5-dimethoxyphenyl)ethylamino]-2-oxoethyl]pentanamide |
| SMILES | CCCCC(=O)NCC(=O)NCCc1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H26N2O4/c1-4-5-6-16(20)19-12-17(21)18-10-9-13-11-14(22-2)7-8-15(13)23-3/h7-8,11H,4-6,9-10,12H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | RQIZMZDONLUXJN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |