C15H24N2O4 — CID 120587964
4-amino-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-methoxybutanamide (PubChem CID 120587964) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-amino-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 120587964 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-amino-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-methoxybutanamide |
| SMILES | COc1ccc(OC)c(CCNC(=O)CC(CN)OC)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-19-12-4-5-14(21-3)11(8-12)6-7-17-15(18)9-13(10-16)20-2/h4-5,8,13H,6-7,9-10,16H2,1-3H3,(H,17,18) |
| InChIKey | DUQMBOVQYQHQHF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |