C34H45NO5 — CID 25178239
N-hexyl-6-[5-[hydroxy-bis(4-methoxyphenyl)methyl]-2-methoxyphenyl]hexanamide (PubChem CID 25178239) has the molecular formula C34H45NO5 and a molecular weight of 547.74 g/mol. Its IUPAC name is N-hexyl-6-[5-[hydroxy-bis(4-methoxyphenyl)methyl]-2-methoxyphenyl]hexanamide.
| Compound Name | N-hexyl-6-[5-[hydroxy-bis(4-methoxyphenyl)methyl]-2-methoxyphenyl]hexanamide |
|---|---|
| PubChem CID | 25178239 |
| Molecular Formula | C34H45NO5 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | N-hexyl-6-[5-[hydroxy-bis(4-methoxyphenyl)methyl]-2-methoxyphenyl]hexanamide |
| SMILES | CCCCCCNC(=O)CCCCCc1cc(C(O)(c2ccc(OC)cc2)c2ccc(OC)cc2)ccc1OC |
| InChI | InChI=1S/C34H45NO5/c1-5-6-7-11-24-35-33(36)13-10-8-9-12-26-25-29(18-23-32(26)40-4)34(37,27-14-19-30(38-2)20-15-27)28-16-21-31(39-3)22-17-28/h14-23,25,37H,5-13,24H2,1-4H3,(H,35,36) |
| InChIKey | KSVMVIWGDMJIEO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|