C37H34O5 — CID 87992844
6-[5-[hydroxy-(4-methoxyphenyl)-pyren-1-ylmethyl]-2-methoxyphenyl]hexanoic acid (PubChem CID 87992844) has the molecular formula C37H34O5 and a molecular weight of 558.67 g/mol. Its IUPAC name is 6-[5-[hydroxy-(4-methoxyphenyl)-pyren-1-ylmethyl]-2-methoxyphenyl]hexanoic acid.
| Compound Name | 6-[5-[hydroxy-(4-methoxyphenyl)-pyren-1-ylmethyl]-2-methoxyphenyl]hexanoic acid |
|---|---|
| PubChem CID | 87992844 |
| Molecular Formula | C37H34O5 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 6-[5-[hydroxy-(4-methoxyphenyl)-pyren-1-ylmethyl]-2-methoxyphenyl]hexanoic acid |
| SMILES | COc1ccc(C(O)(c2ccc(OC)c(CCCCCC(=O)O)c2)c2ccc3ccc4cccc5ccc2c3c45)cc1 |
| InChI | InChI=1S/C37H34O5/c1-41-30-18-15-28(16-19-30)37(40,29-17-22-33(42-2)27(23-29)7-4-3-5-10-34(38)39)32-21-14-26-12-11-24-8-6-9-25-13-20-31(32)36(26)35(24)25/h6,8-9,11-23,40H,3-5,7,10H2,1-2H3,(H,38,39) |
| InChIKey | ANZYEGBAHRVEFI-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|