C37H51NO5 — CID 25178444
6-[5-[hydroxy-bis(4-methoxyphenyl)methyl]-2-methoxyphenyl]-N-nonylhexanamide (PubChem CID 25178444) has the molecular formula C37H51NO5 and a molecular weight of 589.82 g/mol. Its IUPAC name is 6-[5-[hydroxy-bis(4-methoxyphenyl)methyl]-2-methoxyphenyl]-N-nonylhexanamide.
| Compound Name | 6-[5-[hydroxy-bis(4-methoxyphenyl)methyl]-2-methoxyphenyl]-N-nonylhexanamide |
|---|---|
| PubChem CID | 25178444 |
| Molecular Formula | C37H51NO5 |
| Molecular Weight | 589.82 g/mol |
| Exact Mass | 589.38 |
| IUPAC Name | 6-[5-[hydroxy-bis(4-methoxyphenyl)methyl]-2-methoxyphenyl]-N-nonylhexanamide |
| SMILES | CCCCCCCCCNC(=O)CCCCCc1cc(C(O)(c2ccc(OC)cc2)c2ccc(OC)cc2)ccc1OC |
| InChI | InChI=1S/C37H51NO5/c1-5-6-7-8-9-10-14-27-38-36(39)16-13-11-12-15-29-28-32(21-26-35(29)43-4)37(40,30-17-22-33(41-2)23-18-30)31-19-24-34(42-3)25-20-31/h17-26,28,40H,5-16,27H2,1-4H3,(H,38,39) |
| InChIKey | ZRBRUPUHMMAEQW-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.82 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|