C36H27NO7 — CID 91397811
(2,5-dihydroxypyrrol-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate (PubChem CID 91397811) has the molecular formula C36H27NO7 and a molecular weight of 585.61 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate |
|---|---|
| PubChem CID | 91397811 |
| Molecular Formula | C36H27NO7 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[(2,4-dimethoxyphenyl)-hydroxy-pyren-1-ylmethyl]benzoate |
| SMILES | COc1ccc(C(O)(c2cccc(C(=O)On3c(O)ccc3O)c2)c2ccc3ccc4cccc5ccc2c3c45)c(OC)c1 |
| InChI | InChI=1S/C36H27NO7/c1-42-26-13-16-29(30(20-26)43-2)36(41,25-8-4-7-24(19-25)35(40)44-37-31(38)17-18-32(37)39)28-15-12-23-10-9-21-5-3-6-22-11-14-27(28)34(23)33(21)22/h3-20,38-39,41H,1-2H3 |
| InChIKey | FSXRZJOMKVLLNR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|