About (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate
(2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate (PubChem CID 91441562) has the molecular formula C27H25NO7
and a molecular weight of 475.50 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate |
| PubChem CID | 91441562 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate |
| SMILES | COc1ccc(C(OC)(c2ccc(OC)cc2)c2ccc(C(=O)On3c(O)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C27H25NO7/c1-32-22-12-8-20(9-13-22)27(34-3,21-10-14-23(33-2)15-11-21)19-6-4-18(5-7-19)26(31)35-28-24(29)16-17-25(28)30/h4-17,29-30H,1-3H3 |
| InChIKey | GPJUVMCMVYDGJE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate (CID 91441562) is (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate is COc1ccc(C(OC)(c2ccc(OC)cc2)c2ccc(C(=O)On3c(O)ccc3O)cc2)cc1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate?
The InChIKey is GPJUVMCMVYDGJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO7/c1-32-22-12-8-20(9-13-22)27(34-3,21-10-14-23(33-2)15-11-21)19-6-4-18(5-7-19)26(31)35-28-24(29)16-17-25(28)30/h4-17,29-30H,1-3H3.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate?
(2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate has a molecular weight of 475.50 g/mol, XLogP of 4.12, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 4-[methoxy-bis(4-methoxyphenyl)methyl]benzoate is sourced from PubChem (CID 91441562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).