C29H29NO8 — CID 91419436
(2,5-dihydroxypyrrol-1-yl) 4-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]butanoate (PubChem CID 91419436) has the molecular formula C29H29NO8 and a molecular weight of 519.55 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 91419436 |
| Molecular Formula | C29H29NO8 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[4-[hydroxy-bis(4-methoxyphenyl)methyl]phenoxy]butanoate |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)c2ccc(OCCCC(=O)On3c(O)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C29H29NO8/c1-35-23-11-5-20(6-12-23)29(34,21-7-13-24(36-2)14-8-21)22-9-15-25(16-10-22)37-19-3-4-28(33)38-30-26(31)17-18-27(30)32/h5-18,31-32,34H,3-4,19H2,1-2H3 |
| InChIKey | VOUUHLDEUUETFW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|