C13H13NO6 — CID 91318802
(2,5-dihydroxypyrrol-1-yl) 3-(4-hydroxyphenoxy)propanoate (PubChem CID 91318802) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-(4-hydroxyphenoxy)propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-(4-hydroxyphenoxy)propanoate |
|---|---|
| PubChem CID | 91318802 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-(4-hydroxyphenoxy)propanoate |
| SMILES | O=C(CCOc1ccc(O)cc1)On1c(O)ccc1O |
| InChI | InChI=1S/C13H13NO6/c15-9-1-3-10(4-2-9)19-8-7-13(18)20-14-11(16)5-6-12(14)17/h1-6,15-17H,7-8H2 |
| InChIKey | IUWGDXGBCJCKHU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |