C10H14N2O6 — CID 123528431
(2,5-dihydroxypyrrol-1-yl) 3-(2-hydroxyethyliminomethoxy)propanoate (PubChem CID 123528431) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-(2-hydroxyethyliminomethoxy)propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-(2-hydroxyethyliminomethoxy)propanoate |
|---|---|
| PubChem CID | 123528431 |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-(2-hydroxyethyliminomethoxy)propanoate |
| SMILES | O=C(CCO/C=N/CCO)On1c(O)ccc1O |
| InChI | InChI=1S/C10H14N2O6/c13-5-4-11-7-17-6-3-10(16)18-12-8(14)1-2-9(12)15/h1-2,7,13-15H,3-6H2/b11-7+ |
| InChIKey | YHLJPAFWECPQJF-YRNVUSSQSA-N |
| XLogP | -0.72 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|