C20H18ClN3O4 — CID 71692293
2-[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(5-chloro-2-hydroxyphenyl)acetamide (PubChem CID 71692293) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is 2-[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(5-chloro-2-hydroxyphenyl)acetamide.
| Compound Name | 2-[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(5-chloro-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 71692293 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(5-chloro-2-hydroxyphenyl)acetamide |
| SMILES | O=C(CN1C(=O)[C@@H]2CCCN2C(=O)c2ccccc21)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C20H18ClN3O4/c21-12-7-8-17(25)14(10-12)22-18(26)11-24-15-5-2-1-4-13(15)19(27)23-9-3-6-16(23)20(24)28/h1-2,4-5,7-8,10,16,25H,3,6,9,11H2,(H,22,26)/t16-/m0/s1 |
| InChIKey | JZPDHGOLQPQPGJ-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|