C20H16F3N3O3 — CID 53200618
N-(2,4-difluorophenyl)-2-(3-fluoro-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)acetamide (PubChem CID 53200618) has the molecular formula C20H16F3N3O3 and a molecular weight of 403.36 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(3-fluoro-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(3-fluoro-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)acetamide |
|---|---|
| PubChem CID | 53200618 |
| Molecular Formula | C20H16F3N3O3 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(3-fluoro-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2CCCN2C(=O)c2ccc(F)cc21)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H16F3N3O3/c21-11-4-6-15(14(23)8-11)24-18(27)10-26-17-9-12(22)3-5-13(17)19(28)25-7-1-2-16(25)20(26)29/h3-6,8-9,16H,1-2,7,10H2,(H,24,27) |
| InChIKey | AGWBDMKQLSSHDK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |