C14H12F3N3O3 — CID 24534131
2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 24534131) has the molecular formula C14H12F3N3O3 and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 24534131 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)C2CCCN2C1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H12F3N3O3/c15-7-3-4-8(12(17)11(7)16)18-10(21)6-20-13(22)9-2-1-5-19(9)14(20)23/h3-4,9H,1-2,5-6H2,(H,18,21) |
| InChIKey | MOWLQMMBWKGBDU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|