C17H21F3N2O — CID 11931084
2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 11931084) has the molecular formula C17H21F3N2O and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 11931084 |
| Molecular Formula | C17H21F3N2O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CN1CCC[C@H]2CCCC[C@@H]21)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H21F3N2O/c18-12-7-8-13(17(20)16(12)19)21-15(23)10-22-9-3-5-11-4-1-2-6-14(11)22/h7-8,11,14H,1-6,9-10H2,(H,21,23)/t11-,14+/m1/s1 |
| InChIKey | JNKXMVLJDOCIDG-RISCZKNCSA-N |
| XLogP | 3.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|