C16H22FN3O — CID 82751891
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(5-amino-2-fluorophenyl)acetamide (PubChem CID 82751891) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(5-amino-2-fluorophenyl)acetamide.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(5-amino-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 82751891 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(5-amino-2-fluorophenyl)acetamide |
| SMILES | Nc1ccc(F)c(NC(=O)CN2CCC3CCCCC32)c1 |
| InChI | InChI=1S/C16H22FN3O/c17-13-6-5-12(18)9-14(13)19-16(21)10-20-8-7-11-3-1-2-4-15(11)20/h5-6,9,11,15H,1-4,7-8,10,18H2,(H,19,21) |
| InChIKey | OOBJFALTGSTLDO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|