C21H27N3O3 — CID 16676113
2-[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(cyclohexylmethyl)acetamide (PubChem CID 16676113) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 16676113 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-[(6aR)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(cyclohexylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CCCN2C(=O)c2ccccc21)NCC1CCCCC1 |
| InChI | InChI=1S/C21H27N3O3/c25-19(22-13-15-7-2-1-3-8-15)14-24-17-10-5-4-9-16(17)20(26)23-12-6-11-18(23)21(24)27/h4-5,9-10,15,18H,1-3,6-8,11-14H2,(H,22,25)/t18-/m1/s1 |
| InChIKey | NNYYZPTVRPFDBL-GOSISDBHSA-N |
| XLogP | 2.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |