C19H25N3O3 — CID 71692277
2-[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(3-methylbutyl)acetamide (PubChem CID 71692277) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 71692277 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-[(6aS)-6,11-dioxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl]-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CN1C(=O)[C@@H]2CCCN2C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H25N3O3/c1-13(2)9-10-20-17(23)12-22-15-7-4-3-6-14(15)18(24)21-11-5-8-16(21)19(22)25/h3-4,6-7,13,16H,5,8-12H2,1-2H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | VCJSKJVKMOQYIT-INIZCTEOSA-N |
| XLogP | 1.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |