C18H18N4O5S — CID 84571978
ethyl 2-[2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 84571978) has the molecular formula C18H18N4O5S and a molecular weight of 402.43 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 84571978 |
| Molecular Formula | C18H18N4O5S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | ethyl 2-[2-[[2-(2,5-dioxo-4-phenylimidazolidin-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)CN2C(=O)NC(c3ccccc3)C2=O)n1 |
| InChI | InChI=1S/C18H18N4O5S/c1-2-27-14(24)8-12-10-28-17(19-12)20-13(23)9-22-16(25)15(21-18(22)26)11-6-4-3-5-7-11/h3-7,10,15H,2,8-9H2,1H3,(H,21,26)(H,19,20,23) |
| InChIKey | ZDMRTHDQSSPFJM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|