C14H15N3O4S — CID 39149039
ethyl 2-[2-[[2-(2-formylpyrrol-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 39149039) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(2-formylpyrrol-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-(2-formylpyrrol-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 39149039 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | ethyl 2-[2-[[2-(2-formylpyrrol-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)Cn2cccc2C=O)n1 |
| InChI | InChI=1S/C14H15N3O4S/c1-2-21-13(20)6-10-9-22-14(15-10)16-12(19)7-17-5-3-4-11(17)8-18/h3-5,8-9H,2,6-7H2,1H3,(H,15,16,19) |
| InChIKey | HAFQUMCAFKELMA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|