C16H13BrN2O2 — CID 84573205
3-[(4-bromophenyl)methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 84573205) has the molecular formula C16H13BrN2O2 and a molecular weight of 345.20 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[(4-bromophenyl)methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 84573205 |
| Molecular Formula | C16H13BrN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)C(=O)N1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H13BrN2O2/c17-13-8-6-11(7-9-13)10-19-15(20)14(18-16(19)21)12-4-2-1-3-5-12/h1-9,14H,10H2,(H,18,21) |
| InChIKey | JTYIUQZBUVEJHU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|