C16H14FN3O2 — CID 82148999
3-[(4-aminophenyl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 82148999) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is 3-[(4-aminophenyl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(4-aminophenyl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82148999 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-[(4-aminophenyl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | Nc1ccc(CN2C(=O)NC(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C16H14FN3O2/c17-12-5-3-11(4-6-12)14-15(21)20(16(22)19-14)9-10-1-7-13(18)8-2-10/h1-8,14H,9,18H2,(H,19,22) |
| InChIKey | IOBIRBBHUACVJI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|