About 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one
5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one (PubChem CID 11737016) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one |
| PubChem CID | 11737016 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one |
| SMILES | CCN1C(=O)NC(c2ccccc2)C(C(C)=O)=C1C |
| InChI | InChI=1S/C15H18N2O2/c1-4-17-10(2)13(11(3)18)14(16-15(17)19)12-8-6-5-7-9-12/h5-9,14H,4H2,1-3H3,(H,16,19) |
| InChIKey | IKRJEKKSBMJDRD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one?
The IUPAC name of 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one (CID 11737016) is 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one is CCN1C(=O)NC(c2ccccc2)C(C(C)=O)=C1C.
What is the InChIKey of 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one?
The InChIKey is IKRJEKKSBMJDRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2/c1-4-17-10(2)13(11(3)18)14(16-15(17)19)12-8-6-5-7-9-12/h5-9,14H,4H2,1-3H3,(H,16,19).
What are the key properties of 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one?
5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one has a molecular weight of 258.32 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-3-ethyl-4-methyl-6-phenyl-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 11737016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).