C26H29NO7 — CID 54735971
1-O-tert-butyl 4-O-ethyl (2S)-3-hydroxy-5-oxo-2-[(4-phenylmethoxyphenyl)methyl]-2H-pyrrole-1,4-dicarboxylate (PubChem CID 54735971) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl (2S)-3-hydroxy-5-oxo-2-[(4-phenylmethoxyphenyl)methyl]-2H-pyrrole-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl (2S)-3-hydroxy-5-oxo-2-[(4-phenylmethoxyphenyl)methyl]-2H-pyrrole-1,4-dicarboxylate |
|---|---|
| PubChem CID | 54735971 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl (2S)-3-hydroxy-5-oxo-2-[(4-phenylmethoxyphenyl)methyl]-2H-pyrrole-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(O)[C@H](Cc2ccc(OCc3ccccc3)cc2)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C26H29NO7/c1-5-32-24(30)21-22(28)20(27(23(21)29)25(31)34-26(2,3)4)15-17-11-13-19(14-12-17)33-16-18-9-7-6-8-10-18/h6-14,20,28H,5,15-16H2,1-4H3/t20-/m0/s1 |
| InChIKey | QJSQXTWNWLZWTR-FQEVSTJZSA-N |
| XLogP | 4.33 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|