C14H21NO7 — CID 102051304
1-O-tert-butyl 4-O-ethyl (2S)-3-hydroxy-2-[(1R)-1-hydroxyethyl]-5-oxo-2H-pyrrole-1,4-dicarboxylate (PubChem CID 102051304) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl (2S)-3-hydroxy-2-[(1R)-1-hydroxyethyl]-5-oxo-2H-pyrrole-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl (2S)-3-hydroxy-2-[(1R)-1-hydroxyethyl]-5-oxo-2H-pyrrole-1,4-dicarboxylate |
|---|---|
| PubChem CID | 102051304 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl (2S)-3-hydroxy-2-[(1R)-1-hydroxyethyl]-5-oxo-2H-pyrrole-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(O)[C@H]([C@@H](C)O)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C14H21NO7/c1-6-21-12(19)8-10(17)9(7(2)16)15(11(8)18)13(20)22-14(3,4)5/h7,9,16-17H,6H2,1-5H3/t7-,9+/m1/s1 |
| InChIKey | WYUZZINYKGBBRE-APPZFPTMSA-N |
| XLogP | 0.89 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|