C15H23NO7 — CID 171733199
1-O-tert-butyl 2-O,4-O-diethyl (2S)-5-oxopyrrolidine-1,2,4-tricarboxylate (PubChem CID 171733199) has the molecular formula C15H23NO7 and a molecular weight of 329.35 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,4-O-diethyl (2S)-5-oxopyrrolidine-1,2,4-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,4-O-diethyl (2S)-5-oxopyrrolidine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 171733199 |
| Molecular Formula | C15H23NO7 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-O-tert-butyl 2-O,4-O-diethyl (2S)-5-oxopyrrolidine-1,2,4-tricarboxylate |
| SMILES | CCOC(=O)C1C[C@@H](C(=O)OCC)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C15H23NO7/c1-6-21-12(18)9-8-10(13(19)22-7-2)16(11(9)17)14(20)23-15(3,4)5/h9-10H,6-8H2,1-5H3/t9?,10-/m0/s1 |
| InChIKey | SQQYCENIWZRDCN-AXDSSHIGSA-N |
| XLogP | 1.26 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|