C17H28N2O7 — CID 176804428
1-O,2-O-ditert-butyl 3-O-ethyl 5-oxodiazinane-1,2,3-tricarboxylate (PubChem CID 176804428) has the molecular formula C17H28N2O7 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-O,2-O-ditert-butyl 3-O-ethyl 5-oxodiazinane-1,2,3-tricarboxylate.
| Compound Name | 1-O,2-O-ditert-butyl 3-O-ethyl 5-oxodiazinane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 176804428 |
| Molecular Formula | C17H28N2O7 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-O,2-O-ditert-butyl 3-O-ethyl 5-oxodiazinane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)C1CC(=O)CN(C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O7/c1-8-24-13(21)12-9-11(20)10-18(14(22)25-16(2,3)4)19(12)15(23)26-17(5,6)7/h12H,8-10H2,1-7H3 |
| InChIKey | JIXLWZYMEYSGMA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|