C22H29NO6 — CID 10949461
tert-butyl (4S,5S)-4-benzyl-5-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-2-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 10949461) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-benzyl-5-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-2-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-benzyl-5-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-2-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10949461 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | tert-butyl (4S,5S)-4-benzyl-5-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-2-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)/C=C/[C@@H]1OC(=O)N(C(=O)OC(C)(C)C)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H29NO6/c1-21(2,3)28-18(24)13-12-17-16(14-15-10-8-7-9-11-15)23(19(25)27-17)20(26)29-22(4,5)6/h7-13,16-17H,14H2,1-6H3/b13-12+/t16-,17-/m0/s1 |
| InChIKey | XXJYFWSVZLVLTJ-CPQFKCLQSA-N |
| XLogP | 4.25 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|