C19H23NO4 — CID 57293423
tert-butyl (3S)-3-benzyl-2-oxo-5-prop-2-enyl-3H-1,4-oxazine-4-carboxylate (PubChem CID 57293423) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is tert-butyl (3S)-3-benzyl-2-oxo-5-prop-2-enyl-3H-1,4-oxazine-4-carboxylate.
| Compound Name | tert-butyl (3S)-3-benzyl-2-oxo-5-prop-2-enyl-3H-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 57293423 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | tert-butyl (3S)-3-benzyl-2-oxo-5-prop-2-enyl-3H-1,4-oxazine-4-carboxylate |
| SMILES | C=CCC1=COC(=O)[C@H](Cc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23NO4/c1-5-9-15-13-23-17(21)16(12-14-10-7-6-8-11-14)20(15)18(22)24-19(2,3)4/h5-8,10-11,13,16H,1,9,12H2,2-4H3/t16-/m0/s1 |
| InChIKey | CLZOMPNASHCBBB-INIZCTEOSA-N |
| XLogP | 3.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|