C17H23NO3 — CID 122214481
tert-butyl (3R,5R)-5-benzyl-3-ethenyl-1,2-oxazolidine-2-carboxylate (PubChem CID 122214481) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl (3R,5R)-5-benzyl-3-ethenyl-1,2-oxazolidine-2-carboxylate.
| Compound Name | tert-butyl (3R,5R)-5-benzyl-3-ethenyl-1,2-oxazolidine-2-carboxylate |
|---|---|
| PubChem CID | 122214481 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | tert-butyl (3R,5R)-5-benzyl-3-ethenyl-1,2-oxazolidine-2-carboxylate |
| SMILES | C=C[C@H]1C[C@@H](Cc2ccccc2)ON1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO3/c1-5-14-12-15(11-13-9-7-6-8-10-13)21-18(14)16(19)20-17(2,3)4/h5-10,14-15H,1,11-12H2,2-4H3/t14-,15+/m0/s1 |
| InChIKey | UCKJAMMXMXHGAM-LSDHHAIUSA-N |
| XLogP | 3.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|